C12H20N2O5S2 — CID 80655416
methyl 4-[2-(3-methoxypropylsulfonylamino)-1,3-thiazol-4-yl]butanoate (PubChem CID 80655416) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is methyl 4-[2-(3-methoxypropylsulfonylamino)-1,3-thiazol-4-yl]butanoate.
| Compound Name | methyl 4-[2-(3-methoxypropylsulfonylamino)-1,3-thiazol-4-yl]butanoate |
|---|---|
| PubChem CID | 80655416 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl 4-[2-(3-methoxypropylsulfonylamino)-1,3-thiazol-4-yl]butanoate |
| SMILES | COCCCS(=O)(=O)Nc1nc(CCCC(=O)OC)cs1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-18-7-4-8-21(16,17)14-12-13-10(9-20-12)5-3-6-11(15)19-2/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | AXJXREMSWOUNKS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|