C9H11N3O4S2 — CID 80655446
4-[2-(cyanomethylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655446) has the molecular formula C9H11N3O4S2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[2-(cyanomethylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(cyanomethylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655446 |
| Molecular Formula | C9H11N3O4S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-[2-(cyanomethylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | N#CCS(=O)(=O)Nc1nc(CCCC(=O)O)cs1 |
| InChI | InChI=1S/C9H11N3O4S2/c10-4-5-18(15,16)12-9-11-7(6-17-9)2-1-3-8(13)14/h6H,1-3,5H2,(H,11,12)(H,13,14) |
| InChIKey | ZSZDIXJOJAGBBL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |