C11H12N2O4S3 — CID 80655544
4-[2-(thiophen-2-ylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655544) has the molecular formula C11H12N2O4S3 and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-[2-(thiophen-2-ylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(thiophen-2-ylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655544 |
| Molecular Formula | C11H12N2O4S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4-[2-(thiophen-2-ylsulfonylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NS(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C11H12N2O4S3/c14-9(15)4-1-3-8-7-19-11(12-8)13-20(16,17)10-5-2-6-18-10/h2,5-7H,1,3-4H2,(H,12,13)(H,14,15) |
| InChIKey | ZLLRRAHZMXFHQU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |