C11H8N2O2S4 — CID 8603530
N-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 8603530) has the molecular formula C11H8N2O2S4 and a molecular weight of 328.47 g/mol. Its IUPAC name is N-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 8603530 |
| Molecular Formula | C11H8N2O2S4 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2cccs2)cs1)c1cccs1 |
| InChI | InChI=1S/C11H8N2O2S4/c14-19(15,10-4-2-6-17-10)13-11-12-8(7-18-11)9-3-1-5-16-9/h1-7H,(H,12,13) |
| InChIKey | PTPJSNCXTRYDQR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|