C14H9N3O4S3 — CID 108783079
2-oxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 108783079) has the molecular formula C14H9N3O4S3 and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-oxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-oxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 108783079 |
| Molecular Formula | C14H9N3O4S3 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 2-oxo-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)Nc3nc(-c4cccs4)cs3)cc2o1 |
| InChI | InChI=1S/C14H9N3O4S3/c18-14-16-9-4-3-8(6-11(9)21-14)24(19,20)17-13-15-10(7-23-13)12-2-1-5-22-12/h1-7H,(H,15,17)(H,16,18) |
| InChIKey | VQIDVEMRJSQBHD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|