C21H18N4O6S2 — CID 108781120
N-[6-[2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-1,3-thiazol-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetamide (PubChem CID 108781120) has the molecular formula C21H18N4O6S2 and a molecular weight of 486.53 g/mol. Its IUPAC name is N-[6-[2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-1,3-thiazol-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetamide.
| Compound Name | N-[6-[2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-1,3-thiazol-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetamide |
|---|---|
| PubChem CID | 108781120 |
| Molecular Formula | C21H18N4O6S2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[6-[2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-1,3-thiazol-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetamide |
| SMILES | CC(=O)NC1CCOc2ccc(-c3csc(NS(=O)(=O)c4ccc5[nH]c(=O)oc5c4)n3)cc21 |
| InChI | InChI=1S/C21H18N4O6S2/c1-11(26)22-15-6-7-30-18-5-2-12(8-14(15)18)17-10-32-20(23-17)25-33(28,29)13-3-4-16-19(9-13)31-21(27)24-16/h2-5,8-10,15H,6-7H2,1H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | BVWNMKVCMUPXMF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|