C10H10N2O2S3 — CID 108783082
N-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropanesulfonamide (PubChem CID 108783082) has the molecular formula C10H10N2O2S3 and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropanesulfonamide.
| Compound Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropanesulfonamide |
|---|---|
| PubChem CID | 108783082 |
| Molecular Formula | C10H10N2O2S3 |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2cccs2)cs1)C1CC1 |
| InChI | InChI=1S/C10H10N2O2S3/c13-17(14,7-3-4-7)12-10-11-8(6-16-10)9-2-1-5-15-9/h1-2,5-7H,3-4H2,(H,11,12) |
| InChIKey | JDIYDIOZJUTZPC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |