C12H9N3O2S3 — CID 110440548
N-(4-pyridin-3-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 110440548) has the molecular formula C12H9N3O2S3 and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(4-pyridin-3-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4-pyridin-3-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110440548 |
| Molecular Formula | C12H9N3O2S3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | N-(4-pyridin-3-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2cccnc2)cs1)c1cccs1 |
| InChI | InChI=1S/C12H9N3O2S3/c16-20(17,11-4-2-6-18-11)15-12-14-10(8-19-12)9-3-1-5-13-7-9/h1-8H,(H,14,15) |
| InChIKey | VUBXKWORANZRJR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|