C12H14N2O3S — CID 114028540
4-[2-(pent-4-ynoylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 114028540) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-[2-(pent-4-ynoylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(pent-4-ynoylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 114028540 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-[2-(pent-4-ynoylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | C#CCCC(=O)Nc1nc(CCCC(=O)O)cs1 |
| InChI | InChI=1S/C12H14N2O3S/c1-2-3-6-10(15)14-12-13-9(8-18-12)5-4-7-11(16)17/h1,8H,3-7H2,(H,16,17)(H,13,14,15) |
| InChIKey | VUVMMULBVLJBJO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|