C15H20N2O3S — CID 80656609
4-[2-[[2-(cyclohexen-1-yl)acetyl]amino]-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80656609) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-[2-[[2-(cyclohexen-1-yl)acetyl]amino]-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-[[2-(cyclohexen-1-yl)acetyl]amino]-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80656609 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-[2-[[2-(cyclohexen-1-yl)acetyl]amino]-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)CC2=CCCCC2)n1 |
| InChI | InChI=1S/C15H20N2O3S/c18-13(9-11-5-2-1-3-6-11)17-15-16-12(10-21-15)7-4-8-14(19)20/h5,10H,1-4,6-9H2,(H,19,20)(H,16,17,18) |
| InChIKey | CDSWJEOGCACRCZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|