C12H12N2O4S — CID 80656079
4-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80656079) has the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80656079 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C12H12N2O4S/c15-10(16)5-1-3-8-7-19-12(13-8)14-11(17)9-4-2-6-18-9/h2,4,6-7H,1,3,5H2,(H,15,16)(H,13,14,17) |
| InChIKey | UMUDOLMXDMDHJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |