C10H10N2O2S — CID 87065618
N-(4-ethyl-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 87065618) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is N-(4-ethyl-1,3-thiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(4-ethyl-1,3-thiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 87065618 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | N-(4-ethyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | CCc1csc(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C10H10N2O2S/c1-2-7-6-15-10(11-7)12-9(13)8-4-3-5-14-8/h3-6H,2H2,1H3,(H,11,12,13) |
| InChIKey | HNRRVJCUIWKHAF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |