C11H10ClN3O4S2 — CID 107641501
4-chloro-3-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 107641501) has the molecular formula C11H10ClN3O4S2 and a molecular weight of 347.81 g/mol. Its IUPAC name is 4-chloro-3-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 107641501 |
| Molecular Formula | C11H10ClN3O4S2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 4-chloro-3-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | CCc1nnc(NS(=O)(=O)c2cc(C(=O)O)ccc2Cl)s1 |
| InChI | InChI=1S/C11H10ClN3O4S2/c1-2-9-13-14-11(20-9)15-21(18,19)8-5-6(10(16)17)3-4-7(8)12/h3-5H,2H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | YZPPJLJCRLWHKL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |