C19H16Cl2N4O3S2 — CID 2299019
4-[[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]amino]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 2299019) has the molecular formula C19H16Cl2N4O3S2 and a molecular weight of 483.40 g/mol. Its IUPAC name is 4-[[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]amino]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]amino]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2299019 |
| Molecular Formula | C19H16Cl2N4O3S2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 4-[[(E)-3-(3,4-dichlorophenyl)-3-oxoprop-1-enyl]amino]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(N/C=C/C(=O)c3ccc(Cl)c(Cl)c3)cc2)s1 |
| InChI | InChI=1S/C19H16Cl2N4O3S2/c1-2-18-23-24-19(29-18)25-30(27,28)14-6-4-13(5-7-14)22-10-9-17(26)12-3-8-15(20)16(21)11-12/h3-11,22H,2H2,1H3,(H,24,25)/b10-9+ |
| InChIKey | DHLAJDODXDKKQV-MDZDMXLPSA-N |
| XLogP | 5.02 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|