C10H9ClN4O4S2 — CID 103740801
4-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzenesulfonamide (PubChem CID 103740801) has the molecular formula C10H9ClN4O4S2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 4-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 103740801 |
| Molecular Formula | C10H9ClN4O4S2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 4-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C10H9ClN4O4S2/c1-2-9-12-13-10(20-9)14-21(18,19)6-3-4-7(11)8(5-6)15(16)17/h3-5H,2H2,1H3,(H,13,14) |
| InChIKey | GSZMLDPUAYJWJE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|