C9H15N3O2S — CID 18877667
2-methylpropyl N-(5-ethyl-1,3,4-thiadiazol-2-yl)carbamate (PubChem CID 18877667) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-methylpropyl N-(5-ethyl-1,3,4-thiadiazol-2-yl)carbamate.
| Compound Name | 2-methylpropyl N-(5-ethyl-1,3,4-thiadiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 18877667 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-methylpropyl N-(5-ethyl-1,3,4-thiadiazol-2-yl)carbamate |
| SMILES | CCc1nnc(NC(=O)OCC(C)C)s1 |
| InChI | InChI=1S/C9H15N3O2S/c1-4-7-11-12-8(15-7)10-9(13)14-5-6(2)3/h6H,4-5H2,1-3H3,(H,10,12,13) |
| InChIKey | JCRMBMBCBLRHSX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |