C6H9N5OS2 — CID 172909172
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-hydrazinyl-2-sulfanylideneacetamide (PubChem CID 172909172) has the molecular formula C6H9N5OS2 and a molecular weight of 231.31 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-hydrazinyl-2-sulfanylideneacetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-hydrazinyl-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 172909172 |
| Molecular Formula | C6H9N5OS2 |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-hydrazinyl-2-sulfanylideneacetamide |
| SMILES | CCc1nnc(NC(=O)C(=S)NN)s1 |
| InChI | InChI=1S/C6H9N5OS2/c1-2-3-10-11-6(14-3)8-4(12)5(13)9-7/h2,7H2,1H3,(H,9,13)(H,8,11,12) |
| InChIKey | PPKBFRPWXXOPSG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|