C7H7F4N3OS — CID 103733154
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733154) has the molecular formula C7H7F4N3OS and a molecular weight of 257.21 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733154 |
| Molecular Formula | C7H7F4N3OS |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCc1nnc(NC(=O)C(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C7H7F4N3OS/c1-2-3-13-14-6(16-3)12-5(15)7(10,11)4(8)9/h4H,2H2,1H3,(H,12,14,15) |
| InChIKey | AVOWRGWNLSRMBO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|