C7H12N4O2S — CID 94024683
1-[(2S)-1-methoxypropan-2-yl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 94024683) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 1-[(2S)-1-methoxypropan-2-yl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(2S)-1-methoxypropan-2-yl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 94024683 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-[(2S)-1-methoxypropan-2-yl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | COC[C@H](C)NC(=O)Nc1nncs1 |
| InChI | InChI=1S/C7H12N4O2S/c1-5(3-13-2)9-6(12)10-7-11-8-4-14-7/h4-5H,3H2,1-2H3,(H2,9,10,11,12)/t5-/m0/s1 |
| InChIKey | ZFPSNHYRJSSMNS-YFKPBYRVSA-N |
| XLogP | 0.69 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |