C8H13N3OS — CID 44791054
4-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 44791054) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 4-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | 4-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 44791054 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | CC(C)CCC(=O)Nc1nncs1 |
| InChI | InChI=1S/C8H13N3OS/c1-6(2)3-4-7(12)10-8-11-9-5-13-8/h5-6H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | HLMZRCZKNIXUMW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |