C8H10N3O3S- — CID 6924971
(3S)-3-methyl-5-oxo-5-(1,3,4-thiadiazol-2-ylamino)pentanoate (PubChem CID 6924971) has the molecular formula C8H10N3O3S- and a molecular weight of 228.25 g/mol. Its IUPAC name is (3S)-3-methyl-5-oxo-5-(1,3,4-thiadiazol-2-ylamino)pentanoate.
| Compound Name | (3S)-3-methyl-5-oxo-5-(1,3,4-thiadiazol-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 6924971 |
| Molecular Formula | C8H10N3O3S- |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (3S)-3-methyl-5-oxo-5-(1,3,4-thiadiazol-2-ylamino)pentanoate |
| SMILES | C[C@H](CC(=O)[O-])CC(=O)Nc1nncs1 |
| InChI | InChI=1S/C8H11N3O3S/c1-5(3-7(13)14)2-6(12)10-8-11-9-4-15-8/h4-5H,2-3H2,1H3,(H,13,14)(H,10,11,12)/p-1/t5-/m0/s1 |
| InChIKey | OWYYNESMEFQDQD-YFKPBYRVSA-M |
| XLogP | -0.36 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |