C8H14N4OS — CID 61174043
(2S)-2-amino-3-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 61174043) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 61174043 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-(1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C8H14N4OS/c1-3-5(2)6(9)7(13)11-8-12-10-4-14-8/h4-6H,3,9H2,1-2H3,(H,11,12,13)/t5?,6-/m0/s1 |
| InChIKey | XZJCBRQVHFDCQQ-GDVGLLTNSA-N |
| XLogP | 0.85 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |