C17H22N4O2S — CID 119676269
N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-3-methylpentanamide (PubChem CID 119676269) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-3-methylpentanamide.
| Compound Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-3-methylpentanamide |
|---|---|
| PubChem CID | 119676269 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)Nc1nc(-c2ccc(NC(C)=O)cc2)cs1 |
| InChI | InChI=1S/C17H22N4O2S/c1-4-10(2)15(18)16(23)21-17-20-14(9-24-17)12-5-7-13(8-6-12)19-11(3)22/h5-10,15H,4,18H2,1-3H3,(H,19,22)(H,20,21,23) |
| InChIKey | LXJDKYVOPKVMKO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |