C18H22N4O3S — CID 120783216
N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-2-(oxan-4-yl)acetamide (PubChem CID 120783216) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-2-(oxan-4-yl)acetamide.
| Compound Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120783216 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-amino-2-(oxan-4-yl)acetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(NC(=O)C(N)C3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C18H22N4O3S/c1-11(23)20-14-4-2-12(3-5-14)15-10-26-18(21-15)22-17(24)16(19)13-6-8-25-9-7-13/h2-5,10,13,16H,6-9,19H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | HOOUGXCJHKARTL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |