C13H13N3O3S — CID 62489746
2-phenyl-2-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid (PubChem CID 62489746) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-phenyl-2-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid.
| Compound Name | 2-phenyl-2-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 62489746 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-phenyl-2-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid |
| SMILES | CC(NC(=O)Nc1nccs1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O3S/c1-13(10(17)18,9-5-3-2-4-6-9)16-11(19)15-12-14-7-8-20-12/h2-8H,1H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | KGUFQEAWFWIICN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |