C14H13F3N2O3S — CID 88598154
2-methyl-3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid;trifluoromethylbenzene (PubChem CID 88598154) has the molecular formula C14H13F3N2O3S and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid;trifluoromethylbenzene.
| Compound Name | 2-methyl-3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid;trifluoromethylbenzene |
|---|---|
| PubChem CID | 88598154 |
| Molecular Formula | C14H13F3N2O3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-methyl-3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid;trifluoromethylbenzene |
| SMILES | CC(C(=O)O)C(=O)Nc1nccs1.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C7H5F3.C7H8N2O3S/c8-7(9,10)6-4-2-1-3-5-6;1-4(6(11)12)5(10)9-7-8-2-3-13-7/h1-5H;2-4H,1H3,(H,11,12)(H,8,9,10) |
| InChIKey | VFDXSVWRPQCPJJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|