C15H26N4OS — CID 142671530
1-[2-(cyclopentylamino)-4-methylpentyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 142671530) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-[2-(cyclopentylamino)-4-methylpentyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(cyclopentylamino)-4-methylpentyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 142671530 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[2-(cyclopentylamino)-4-methylpentyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC(C)CC(CNC(=O)Nc1nccs1)NC1CCCC1 |
| InChI | InChI=1S/C15H26N4OS/c1-11(2)9-13(18-12-5-3-4-6-12)10-17-14(20)19-15-16-7-8-21-15/h7-8,11-13,18H,3-6,9-10H2,1-2H3,(H2,16,17,19,20) |
| InChIKey | LCSRQYBTTCRGFU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |