C15H22N6OS2 — CID 55536177
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 55536177) has the molecular formula C15H22N6OS2 and a molecular weight of 366.52 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 55536177 |
| Molecular Formula | C15H22N6OS2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | CSc1nnc(CCCNC(=O)Nc2nccs2)n1C1CCCC1 |
| InChI | InChI=1S/C15H22N6OS2/c1-23-15-20-19-12(21(15)11-5-2-3-6-11)7-4-8-16-13(22)18-14-17-9-10-24-14/h9-11H,2-8H2,1H3,(H2,16,17,18,22) |
| InChIKey | XSXOOVRMNCSFPF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|