C18H24ClN5OS — CID 51290563
1-(2-chlorophenyl)-3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]urea (PubChem CID 51290563) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]urea |
|---|---|
| PubChem CID | 51290563 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]urea |
| SMILES | CSc1nnc(CCCNC(=O)Nc2ccccc2Cl)n1C1CCCC1 |
| InChI | InChI=1S/C18H24ClN5OS/c1-26-18-23-22-16(24(18)13-7-2-3-8-13)11-6-12-20-17(25)21-15-10-5-4-9-14(15)19/h4-5,9-10,13H,2-3,6-8,11-12H2,1H3,(H2,20,21,25) |
| InChIKey | UJXAJCCCRDJOOZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|