C20H27BrN4OS2 — CID 55913115
3-(2-bromophenyl)sulfanyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]propanamide (PubChem CID 55913115) has the molecular formula C20H27BrN4OS2 and a molecular weight of 483.50 g/mol. Its IUPAC name is 3-(2-bromophenyl)sulfanyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]propanamide.
| Compound Name | 3-(2-bromophenyl)sulfanyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 55913115 |
| Molecular Formula | C20H27BrN4OS2 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 3-(2-bromophenyl)sulfanyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]propanamide |
| SMILES | CSc1nnc(CCCNC(=O)CCSc2ccccc2Br)n1C1CCCC1 |
| InChI | InChI=1S/C20H27BrN4OS2/c1-27-20-24-23-18(25(20)15-7-2-3-8-15)11-6-13-22-19(26)12-14-28-17-10-5-4-9-16(17)21/h4-5,9-10,15H,2-3,6-8,11-14H2,1H3,(H,22,26) |
| InChIKey | YPGQOARBSKCEJU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|