C22H33N5O3S2 — CID 55408313
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide (PubChem CID 55408313) has the molecular formula C22H33N5O3S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55408313 |
| Molecular Formula | C22H33N5O3S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide |
| SMILES | CSc1nnc(CCCNC(=O)CCNS(=O)(=O)c2ccc(C)cc2C)n1C1CCCC1 |
| InChI | InChI=1S/C22H33N5O3S2/c1-16-10-11-19(17(2)15-16)32(29,30)24-14-12-21(28)23-13-6-9-20-25-26-22(31-3)27(20)18-7-4-5-8-18/h10-11,15,18,24H,4-9,12-14H2,1-3H3,(H,23,28) |
| InChIKey | HRQLUIXHYRYEIF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|