C22H31N5O3S2 — CID 55911459
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(cyclopropylmethylsulfamoyl)benzamide (PubChem CID 55911459) has the molecular formula C22H31N5O3S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(cyclopropylmethylsulfamoyl)benzamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(cyclopropylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55911459 |
| Molecular Formula | C22H31N5O3S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(cyclopropylmethylsulfamoyl)benzamide |
| SMILES | CSc1nnc(CCCNC(=O)c2cccc(S(=O)(=O)NCC3CC3)c2)n1C1CCCC1 |
| InChI | InChI=1S/C22H31N5O3S2/c1-31-22-26-25-20(27(22)18-7-2-3-8-18)10-5-13-23-21(28)17-6-4-9-19(14-17)32(29,30)24-15-16-11-12-16/h4,6,9,14,16,18,24H,2-3,5,7-8,10-13,15H2,1H3,(H,23,28) |
| InChIKey | CCXNDFZCUAUEFL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|