C20H25N7OS — CID 55533125
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-6-pyrazol-1-ylpyridine-3-carboxamide (PubChem CID 55533125) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-6-pyrazol-1-ylpyridine-3-carboxamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-6-pyrazol-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55533125 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-6-pyrazol-1-ylpyridine-3-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)c2ccc(-n3cccn3)nc2)n1C1CCCC1 |
| InChI | InChI=1S/C20H25N7OS/c1-29-20-25-24-18(27(20)16-6-2-3-7-16)8-4-11-21-19(28)15-9-10-17(22-14-15)26-13-5-12-23-26/h5,9-10,12-14,16H,2-4,6-8,11H2,1H3,(H,21,28) |
| InChIKey | QHFUJABPSNEGET-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|