C18H24FN5OS — CID 51250456
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(4-fluorophenyl)urea (PubChem CID 51250456) has the molecular formula C18H24FN5OS and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 51250456 |
| Molecular Formula | C18H24FN5OS |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(4-fluorophenyl)urea |
| SMILES | CSc1nnc(CCCNC(=O)Nc2ccc(F)cc2)n1C1CCCC1 |
| InChI | InChI=1S/C18H24FN5OS/c1-26-18-23-22-16(24(18)15-5-2-3-6-15)7-4-12-20-17(25)21-14-10-8-13(19)9-11-14/h8-11,15H,2-7,12H2,1H3,(H2,20,21,25) |
| InChIKey | IYLXUQUNCHMWOZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|