C15H25N5O3S — CID 122000614
3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propylcarbamoylamino]propanoic acid (PubChem CID 122000614) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propylcarbamoylamino]propanoic acid.
| Compound Name | 3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122000614 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propylcarbamoylamino]propanoic acid |
| SMILES | CSc1nnc(CCCNC(=O)NCCC(=O)O)n1C1CCCC1 |
| InChI | InChI=1S/C15H25N5O3S/c1-24-15-19-18-12(20(15)11-5-2-3-6-11)7-4-9-16-14(23)17-10-8-13(21)22/h11H,2-10H2,1H3,(H,21,22)(H2,16,17,23) |
| InChIKey | JETHLNIXXSEJNG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|