C20H25F3N4OS — CID 55396152
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 55396152) has the molecular formula C20H25F3N4OS and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55396152 |
| Molecular Formula | C20H25F3N4OS |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CSc1nnc(CCCNC(=O)Cc2cccc(C(F)(F)F)c2)n1C1CCCC1 |
| InChI | InChI=1S/C20H25F3N4OS/c1-29-19-26-25-17(27(19)16-8-2-3-9-16)10-5-11-24-18(28)13-14-6-4-7-15(12-14)20(21,22)23/h4,6-7,12,16H,2-3,5,8-11,13H2,1H3,(H,24,28) |
| InChIKey | IFDCMAPEMQYBDK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|