C23H33N5O3S2 — CID 55396175
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55396175) has the molecular formula C23H33N5O3S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55396175 |
| Molecular Formula | C23H33N5O3S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CSc1nnc(CCCNC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)n1C1CCCC1 |
| InChI | InChI=1S/C23H33N5O3S2/c1-32-23-26-25-21(28(23)19-10-3-4-11-19)13-8-14-24-22(29)18-9-7-12-20(17-18)33(30,31)27-15-5-2-6-16-27/h7,9,12,17,19H,2-6,8,10-11,13-16H2,1H3,(H,24,29) |
| InChIKey | XTKZULLOAOOLCS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|