C21H31N5O3S3 — CID 17415448
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 17415448) has the molecular formula C21H31N5O3S3 and a molecular weight of 497.71 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 17415448 |
| Molecular Formula | C21H31N5O3S3 |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)n1C1CCCC1 |
| InChI | InChI=1S/C21H31N5O3S3/c1-30-21-24-23-18(26(21)17-8-2-3-9-17)10-4-12-22-20(27)16-7-5-13-25(15-16)32(28,29)19-11-6-14-31-19/h6,11,14,16-17H,2-5,7-10,12-13,15H2,1H3,(H,22,27) |
| InChIKey | ONAJTLLDJWOALH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|