C26H30N6O2S — CID 134009662
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzamide (PubChem CID 134009662) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 134009662 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzamide |
| SMILES | CSc1nnc(CCCNC(=O)c2cccc(OCc3cn4ccccc4n3)c2)n1C1CCCC1 |
| InChI | InChI=1S/C26H30N6O2S/c1-35-26-30-29-24(32(26)21-9-2-3-10-21)13-7-14-27-25(33)19-8-6-11-22(16-19)34-18-20-17-31-15-5-4-12-23(31)28-20/h4-6,8,11-12,15-17,21H,2-3,7,9-10,13-14,18H2,1H3,(H,27,33) |
| InChIKey | BHSAKSUDIFRGIP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|