C22H29N5O2S2 — CID 55942254
(4R)-3-benzoyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 55942254) has the molecular formula C22H29N5O2S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is (4R)-3-benzoyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-benzoyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 55942254 |
| Molecular Formula | C22H29N5O2S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (4R)-3-benzoyl-N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)[C@@H]2CSCN2C(=O)c2ccccc2)n1C1CCCC1 |
| InChI | InChI=1S/C22H29N5O2S2/c1-30-22-25-24-19(27(22)17-10-5-6-11-17)12-7-13-23-20(28)18-14-31-15-26(18)21(29)16-8-3-2-4-9-16/h2-4,8-9,17-18H,5-7,10-15H2,1H3,(H,23,28)/t18-/m0/s1 |
| InChIKey | OGIJQIYNBVWTFU-SFHVURJKSA-N |
| XLogP | 3.38 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|