C14H19Cl2NO2S — CID 80584775
1-(3,4-dichlorophenoxy)-3-(thiolan-2-ylmethylamino)propan-2-ol (PubChem CID 80584775) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenoxy)-3-(thiolan-2-ylmethylamino)propan-2-ol.
| Compound Name | 1-(3,4-dichlorophenoxy)-3-(thiolan-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 80584775 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-(3,4-dichlorophenoxy)-3-(thiolan-2-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCC1CCCS1)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO2S/c15-13-4-3-11(6-14(13)16)19-9-10(18)7-17-8-12-2-1-5-20-12/h3-4,6,10,12,17-18H,1-2,5,7-9H2 |
| InChIKey | CCWJOWVGVDATNP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |