C13H18Cl2N2O3 — CID 60632295
N-[2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]acetamide (PubChem CID 60632295) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is N-[2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 60632295 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O3/c1-9(18)17-5-4-16-7-10(19)8-20-11-2-3-12(14)13(15)6-11/h2-3,6,10,16,19H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | YWHXSFABEMSAMJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|