C21H29NO4 — CID 51134068
3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 51134068) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 51134068 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | Cc1cccc(C)c1OCC(O)CN1C(=O)CC2(CCCCC2)CC1=O |
| InChI | InChI=1S/C21H29NO4/c1-15-7-6-8-16(2)20(15)26-14-17(23)13-22-18(24)11-21(12-19(22)25)9-4-3-5-10-21/h6-8,17,23H,3-5,9-14H2,1-2H3 |
| InChIKey | JKFAPIGSUDQEAU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|