C25H37F3N4O4Si — CID 15840655
3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione (PubChem CID 15840655) has the molecular formula C25H37F3N4O4Si and a molecular weight of 542.68 g/mol. Its IUPAC name is 3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15840655 |
| Molecular Formula | C25H37F3N4O4Si |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCn1ccc(=O)n(CCCN2CCN(c3ccccc3OCC(F)(F)F)CC2)c1=O |
| InChI | InChI=1S/C25H37F3N4O4Si/c1-37(2,3)18-17-35-20-31-12-9-23(33)32(24(31)34)11-6-10-29-13-15-30(16-14-29)21-7-4-5-8-22(21)36-19-25(26,27)28/h4-5,7-9,12H,6,10-11,13-20H2,1-3H3 |
| InChIKey | CXKLYJNQDGWHKX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|