C25H26ClF3N4O3 — CID 10673603
8-chloro-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxylic acid (PubChem CID 10673603) has the molecular formula C25H26ClF3N4O3 and a molecular weight of 522.96 g/mol. Its IUPAC name is 8-chloro-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxylic acid.
| Compound Name | 8-chloro-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10673603 |
| Molecular Formula | C25H26ClF3N4O3 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 8-chloro-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2c(Cl)cccc2c1NCCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C25H26ClF3N4O3/c26-19-6-3-5-17-22(18(24(34)35)15-31-23(17)19)30-9-4-10-32-11-13-33(14-12-32)20-7-1-2-8-21(20)36-16-25(27,28)29/h1-3,5-8,15H,4,9-14,16H2,(H,30,31)(H,34,35) |
| InChIKey | OKIGTOQZVOKEBO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|