C25H26F4N4O3 — CID 23447869
N-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 23447869) has the molecular formula C25H26F4N4O3 and a molecular weight of 506.50 g/mol. Its IUPAC name is N-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23447869 |
| Molecular Formula | C25H26F4N4O3 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | N-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2OCC(F)(F)F)CC1)c1conc1-c1ccccc1 |
| InChI | InChI=1S/C25H26F4N4O3/c26-19-7-8-21(22(15-19)35-17-25(27,28)29)33-13-11-32(12-14-33)10-4-9-30-24(34)20-16-36-31-23(20)18-5-2-1-3-6-18/h1-3,5-8,15-16H,4,9-14,17H2,(H,30,34) |
| InChIKey | VYMRMWQILRQHOS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|