C21H25F3N4O2 — CID 141363458
N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 141363458) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141363458 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C21H25F3N4O2/c1-30-18-6-3-2-5-17(18)28-13-11-27(12-14-28)10-4-9-25-20(29)16-7-8-19(26-15-16)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3,(H,25,29) |
| InChIKey | UPBYUCQDTNTYHE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|