C26H31FN4O4 — CID 142654726
N-[3-[4-[5-(fluoromethoxy)-2-methoxyphenyl]piperazin-1-yl]propyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 142654726) has the molecular formula C26H31FN4O4 and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[3-[4-[5-(fluoromethoxy)-2-methoxyphenyl]piperazin-1-yl]propyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[3-[4-[5-(fluoromethoxy)-2-methoxyphenyl]piperazin-1-yl]propyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 142654726 |
| Molecular Formula | C26H31FN4O4 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-[3-[4-[5-(fluoromethoxy)-2-methoxyphenyl]piperazin-1-yl]propyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | COc1ccc(OCF)cc1N1CCN(CCCNC(=O)c2c(-c3ccccc3)noc2C)CC1 |
| InChI | InChI=1S/C26H31FN4O4/c1-19-24(25(29-35-19)20-7-4-3-5-8-20)26(32)28-11-6-12-30-13-15-31(16-14-30)22-17-21(34-18-27)9-10-23(22)33-2/h3-5,7-10,17H,6,11-16,18H2,1-2H3,(H,28,32) |
| InChIKey | NBKMOBDSQRELBZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|