C24H34F2N3O7P — CID 15985598
[6-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 15985598) has the molecular formula C24H34F2N3O7P and a molecular weight of 545.52 g/mol. Its IUPAC name is [6-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [6-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 15985598 |
| Molecular Formula | C24H34F2N3O7P |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | [6-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CCCN2C(=O)C3CC(F)C(OP(=O)(O)O)CC3C2=O)CC1 |
| InChI | InChI=1S/C24H34F2N3O7P/c1-15(2)35-21-5-4-16(25)12-20(21)28-10-8-27(9-11-28)6-3-7-29-23(30)17-13-19(26)22(36-37(32,33)34)14-18(17)24(29)31/h4-5,12,15,17-19,22H,3,6-11,13-14H2,1-2H3,(H2,32,33,34) |
| InChIKey | BRNYXFYJCROCNP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|