C24H35FN3O7+ — CID 91518544
2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)-1-hydroxypiperazin-1-ium-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,4,5,6-pentol (PubChem CID 91518544) has the molecular formula C24H35FN3O7+ and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)-1-hydroxypiperazin-1-ium-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,4,5,6-pentol.
| Compound Name | 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)-1-hydroxypiperazin-1-ium-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,4,5,6-pentol |
|---|---|
| PubChem CID | 91518544 |
| Molecular Formula | C24H35FN3O7+ |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)-1-hydroxypiperazin-1-ium-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,4,5,6-pentol |
| SMILES | CC(C)Oc1ccc(F)cc1N1CC[N+](O)(CCCn2c(O)c3c(c2O)C(O)C(O)C(O)C3)CC1 |
| InChI | InChI=1S/C24H34FN3O7/c1-14(2)35-19-5-4-15(25)12-17(19)26-7-10-28(34,11-8-26)9-3-6-27-23(32)16-13-18(29)21(30)22(31)20(16)24(27)33/h4-5,12,14,18,21-22,29-31,34H,3,6-11,13H2,1-2H3,(H-,32,33)/p+1 |
| InChIKey | MMMVQRNBFUVCDW-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|